C12H15N3O3S — CID 103995370
4-amino-2-(2-methylsulfonylethyl)-5-phenyl-1H-pyrazol-3-one (PubChem CID 103995370) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-amino-2-(2-methylsulfonylethyl)-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-amino-2-(2-methylsulfonylethyl)-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 103995370 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-amino-2-(2-methylsulfonylethyl)-5-phenyl-1H-pyrazol-3-one |
| SMILES | CS(=O)(=O)CCn1[nH]c(-c2ccccc2)c(N)c1=O |
| InChI | InChI=1S/C12H15N3O3S/c1-19(17,18)8-7-15-12(16)10(13)11(14-15)9-5-3-2-4-6-9/h2-6,14H,7-8,13H2,1H3 |
| InChIKey | JQKADKLLVHVCIS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |