About N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide
N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide (PubChem CID 10400703) has the molecular formula C15H14N4O
and a molecular weight of 266.30 g/mol. Its IUPAC name is N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide.
Molecular Properties
| Compound Name | N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide |
| PubChem CID | 10400703 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide |
| SMILES | N#CN/C(=N\CCOc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C15H14N4O/c16-12-19-15(13-5-4-8-17-11-13)18-9-10-20-14-6-2-1-3-7-14/h1-8,11H,9-10H2,(H,18,19) |
| InChIKey | OAQLYANRTRGDFS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide?
The IUPAC name of N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide (CID 10400703) is N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide.
What is the SMILES notation for N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide?
The canonical SMILES for N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide is N#CN/C(=N\CCOc1ccccc1)c1cccnc1.
What is the InChIKey of N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide?
The InChIKey is OAQLYANRTRGDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O/c16-12-19-15(13-5-4-8-17-11-13)18-9-10-20-14-6-2-1-3-7-14/h1-8,11H,9-10H2,(H,18,19).
What are the key properties of N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide?
N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide has a molecular weight of 266.30 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-(2-phenoxyethyl)pyridine-3-carboximidamide is sourced from PubChem (CID 10400703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).