C20H21NO2S — CID 10404940
1'-(3-methylphenyl)sulfonylspiro[indene-1,4'-piperidine] (PubChem CID 10404940) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1'-(3-methylphenyl)sulfonylspiro[indene-1,4'-piperidine].
| Compound Name | 1'-(3-methylphenyl)sulfonylspiro[indene-1,4'-piperidine] |
|---|---|
| PubChem CID | 10404940 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1'-(3-methylphenyl)sulfonylspiro[indene-1,4'-piperidine] |
| SMILES | Cc1cccc(S(=O)(=O)N2CCC3(C=Cc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C20H21NO2S/c1-16-5-4-7-18(15-16)24(22,23)21-13-11-20(12-14-21)10-9-17-6-2-3-8-19(17)20/h2-10,15H,11-14H2,1H3 |
| InChIKey | LXURPPOZXNGGAE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |