C24H16Br2N2O4 — CID 1040501
1,3-bis[2-(4-bromophenyl)-2-oxoethyl]quinazoline-2,4-dione (PubChem CID 1040501) has the molecular formula C24H16Br2N2O4 and a molecular weight of 556.21 g/mol. Its IUPAC name is 1,3-bis[2-(4-bromophenyl)-2-oxoethyl]quinazoline-2,4-dione.
| Compound Name | 1,3-bis[2-(4-bromophenyl)-2-oxoethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 1040501 |
| Molecular Formula | C24H16Br2N2O4 |
| Molecular Weight | 556.21 g/mol |
| Exact Mass | 553.95 |
| IUPAC Name | 1,3-bis[2-(4-bromophenyl)-2-oxoethyl]quinazoline-2,4-dione |
| SMILES | O=C(Cn1c(=O)c2ccccc2n(CC(=O)c2ccc(Br)cc2)c1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H16Br2N2O4/c25-17-9-5-15(6-10-17)21(29)13-27-20-4-2-1-3-19(20)23(31)28(24(27)32)14-22(30)16-7-11-18(26)12-8-16/h1-12H,13-14H2 |
| InChIKey | JNMNHVQRVHBHIX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |