C21H20N2O3 — CID 10405460
methyl (5E)-9-benzyl-5-hydroxyimino-7,8-dihydro-6H-carbazole-1-carboxylate (PubChem CID 10405460) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl (5E)-9-benzyl-5-hydroxyimino-7,8-dihydro-6H-carbazole-1-carboxylate.
| Compound Name | methyl (5E)-9-benzyl-5-hydroxyimino-7,8-dihydro-6H-carbazole-1-carboxylate |
|---|---|
| PubChem CID | 10405460 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl (5E)-9-benzyl-5-hydroxyimino-7,8-dihydro-6H-carbazole-1-carboxylate |
| SMILES | COC(=O)c1cccc2c3c(n(Cc4ccccc4)c12)CCC/C3=N\O |
| InChI | InChI=1S/C21H20N2O3/c1-26-21(24)16-10-5-9-15-19-17(22-25)11-6-12-18(19)23(20(15)16)13-14-7-3-2-4-8-14/h2-5,7-10,25H,6,11-13H2,1H3/b22-17+ |
| InChIKey | MZMHAKPEHPHLHN-OQKWZONESA-N |
| XLogP | 3.99 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|