C16H18N2O2 — CID 11414560
methyl 1-benzyl-4,5,6,7-tetrahydrobenzimidazole-2-carboxylate (PubChem CID 11414560) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 1-benzyl-4,5,6,7-tetrahydrobenzimidazole-2-carboxylate.
| Compound Name | methyl 1-benzyl-4,5,6,7-tetrahydrobenzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 11414560 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | methyl 1-benzyl-4,5,6,7-tetrahydrobenzimidazole-2-carboxylate |
| SMILES | COC(=O)c1nc2c(n1Cc1ccccc1)CCCC2 |
| InChI | InChI=1S/C16H18N2O2/c1-20-16(19)15-17-13-9-5-6-10-14(13)18(15)11-12-7-3-2-4-8-12/h2-4,7-8H,5-6,9-11H2,1H3 |
| InChIKey | NKZZSRRMGLWTNQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |