C21H23NO5 — CID 10406782
dimethyl (3R,6S)-6-methyl-2,3-diphenyloxazinane-4,4-dicarboxylate (PubChem CID 10406782) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is dimethyl (3R,6S)-6-methyl-2,3-diphenyloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl (3R,6S)-6-methyl-2,3-diphenyloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10406782 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | dimethyl (3R,6S)-6-methyl-2,3-diphenyloxazinane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](C)ON(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23NO5/c1-15-14-21(19(23)25-2,20(24)26-3)18(16-10-6-4-7-11-16)22(27-15)17-12-8-5-9-13-17/h4-13,15,18H,14H2,1-3H3/t15-,18+/m0/s1 |
| InChIKey | WUXKPGOGPDOWIZ-MAUKXSAKSA-N |
| XLogP | 3.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|