C23H27NO5 — CID 10069389
dimethyl (3R,6R)-2,6-diphenyl-3-propan-2-yloxazinane-4,4-dicarboxylate (PubChem CID 10069389) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is dimethyl (3R,6R)-2,6-diphenyl-3-propan-2-yloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl (3R,6R)-2,6-diphenyl-3-propan-2-yloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10069389 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | dimethyl (3R,6R)-2,6-diphenyl-3-propan-2-yloxazinane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2ccccc2)ON(c2ccccc2)[C@@H]1C(C)C |
| InChI | InChI=1S/C23H27NO5/c1-16(2)20-23(21(25)27-3,22(26)28-4)15-19(17-11-7-5-8-12-17)29-24(20)18-13-9-6-10-14-18/h5-14,16,19-20H,15H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | RFNPSAIXZSOVHW-WOJBJXKFSA-N |
| XLogP | 3.93 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|