C22H23NO5 — CID 10407473
dimethyl (3R,6R)-6-ethenyl-2,3-diphenyloxazinane-4,4-dicarboxylate (PubChem CID 10407473) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is dimethyl (3R,6R)-6-ethenyl-2,3-diphenyloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl (3R,6R)-6-ethenyl-2,3-diphenyloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10407473 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | dimethyl (3R,6R)-6-ethenyl-2,3-diphenyloxazinane-4,4-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](c2ccccc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C22H23NO5/c1-4-18-15-22(20(24)26-2,21(25)27-3)19(16-11-7-5-8-12-16)23(28-18)17-13-9-6-10-14-17/h4-14,18-19H,1,15H2,2-3H3/t18-,19+/m0/s1 |
| InChIKey | OMSVMULUWJWKDK-RBUKOAKNSA-N |
| XLogP | 3.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|