C18H21F3O4S — CID 10408056
[2-[2-(2,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-4-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 10408056) has the molecular formula C18H21F3O4S and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-[2-(2,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-4-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[2-(2,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-4-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10408056 |
| Molecular Formula | C18H21F3O4S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [2-[2-(2,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-4-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)C(F)(F)F)c(CCC2=C(C)CCC=C2C)c1 |
| InChI | InChI=1S/C18H21F3O4S/c1-12-5-4-6-13(2)16(12)9-7-14-11-15(24-3)8-10-17(14)25-26(22,23)18(19,20)21/h5,8,10-11H,4,6-7,9H2,1-3H3 |
| InChIKey | LGIMBDQFGWJDDJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|