C22H23N3O4 — CID 10408253
ethyl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylfuro[2,3-b]pyridine-2-carboxylate (PubChem CID 10408253) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylfuro[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylfuro[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 10408253 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | ethyl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylfuro[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1oc2nc(-c3ccccc3)cc(C)c2c1/N=C/N1CCOCC1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-28-22(26)20-19(23-14-25-9-11-27-12-10-25)18-15(2)13-17(24-21(18)29-20)16-7-5-4-6-8-16/h4-8,13-14H,3,9-12H2,1-2H3/b23-14+ |
| InChIKey | NNYWQNUBMFPEIL-OEAKJJBVSA-N |
| XLogP | 3.97 |
| TPSA | 77.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|