C23H25N3O3S — CID 10342251
propan-2-yl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 10342251) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is propan-2-yl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | propan-2-yl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 10342251 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | propan-2-yl 4-methyl-3-(morpholin-4-ylmethylideneamino)-6-phenylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | Cc1cc(-c2ccccc2)nc2sc(C(=O)OC(C)C)c(/N=C/N3CCOCC3)c12 |
| InChI | InChI=1S/C23H25N3O3S/c1-15(2)29-23(27)21-20(24-14-26-9-11-28-12-10-26)19-16(3)13-18(25-22(19)30-21)17-7-5-4-6-8-17/h4-8,13-15H,9-12H2,1-3H3/b24-14+ |
| InChIKey | NKZDLDOGRZHWKK-ZVHZXABRSA-N |
| XLogP | 4.83 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|