C24H27BrN4O2S — CID 110193624
4-(4-bromophenyl)-N,N-diethyl-6-methyl-3-(morpholin-4-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 110193624) has the molecular formula C24H27BrN4O2S and a molecular weight of 515.48 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N,N-diethyl-6-methyl-3-(morpholin-4-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(4-bromophenyl)-N,N-diethyl-6-methyl-3-(morpholin-4-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110193624 |
| Molecular Formula | C24H27BrN4O2S |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 4-(4-bromophenyl)-N,N-diethyl-6-methyl-3-(morpholin-4-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1sc2nc(C)cc(-c3ccc(Br)cc3)c2c1/N=C/N1CCOCC1 |
| InChI | InChI=1S/C24H27BrN4O2S/c1-4-29(5-2)24(30)22-21(26-15-28-10-12-31-13-11-28)20-19(14-16(3)27-23(20)32-22)17-6-8-18(25)9-7-17/h6-9,14-15H,4-5,10-13H2,1-3H3/b26-15+ |
| InChIKey | FVJUCMUIKJKHMZ-CVKSISIWSA-N |
| XLogP | 5.51 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|