C26H31ClN4O2S — CID 110193590
4-(4-chlorophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid;piperidine (PubChem CID 110193590) has the molecular formula C26H31ClN4O2S and a molecular weight of 499.08 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid;piperidine.
| Compound Name | 4-(4-chlorophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid;piperidine |
|---|---|
| PubChem CID | 110193590 |
| Molecular Formula | C26H31ClN4O2S |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-(4-chlorophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid;piperidine |
| SMILES | C1CCNCC1.Cc1cc(-c2ccc(Cl)cc2)c2c(/N=C/N3CCCCC3)c(C(=O)O)sc2n1 |
| InChI | InChI=1S/C21H20ClN3O2S.C5H11N/c1-13-11-16(14-5-7-15(22)8-6-14)17-18(19(21(26)27)28-20(17)24-13)23-12-25-9-3-2-4-10-25;1-2-4-6-5-3-1/h5-8,11-12H,2-4,9-10H2,1H3,(H,26,27);6H,1-5H2/b23-12+; |
| InChIKey | GWUJIZHHKLMRAU-RRHSQXQGSA-N |
| XLogP | 6.53 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|