C19H13ClN2O3S — CID 110193555
13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid (PubChem CID 110193555) has the molecular formula C19H13ClN2O3S and a molecular weight of 384.84 g/mol. Its IUPAC name is 13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid.
| Compound Name | 13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid |
|---|---|
| PubChem CID | 110193555 |
| Molecular Formula | C19H13ClN2O3S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid |
| SMILES | COc1cc(C(=O)O)nc2c1sc1nc(C)cc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C19H13ClN2O3S/c1-9-7-12(10-3-5-11(20)6-4-10)15-16-17(26-18(15)21-9)14(25-2)8-13(22-16)19(23)24/h3-8H,1-2H3,(H,23,24) |
| InChIKey | OJNHNRXWTOGKCK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |