C24H15Cl2N3O3S — CID 110193716
methyl 11,13-bis(4-chlorophenyl)-6-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carboxylate (PubChem CID 110193716) has the molecular formula C24H15Cl2N3O3S and a molecular weight of 496.38 g/mol. Its IUPAC name is methyl 11,13-bis(4-chlorophenyl)-6-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carboxylate.
| Compound Name | methyl 11,13-bis(4-chlorophenyl)-6-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 110193716 |
| Molecular Formula | C24H15Cl2N3O3S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | methyl 11,13-bis(4-chlorophenyl)-6-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carboxylate |
| SMILES | COC(=O)c1nc(OC)c2sc3nc(-c4ccc(Cl)cc4)cc(-c4ccc(Cl)cc4)c3c2n1 |
| InChI | InChI=1S/C24H15Cl2N3O3S/c1-31-22-20-19(28-21(29-22)24(30)32-2)18-16(12-3-7-14(25)8-4-12)11-17(27-23(18)33-20)13-5-9-15(26)10-6-13/h3-11H,1-2H3 |
| InChIKey | XYSZVINMSHINAU-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |