C19H17ClN2O5S — CID 110193554
13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid;dihydrate (PubChem CID 110193554) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is 13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid;dihydrate.
| Compound Name | 13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid;dihydrate |
|---|---|
| PubChem CID | 110193554 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 13-(4-chlorophenyl)-6-methoxy-11-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carboxylic acid;dihydrate |
| SMILES | COc1cc(C(=O)O)nc2c1sc1nc(C)cc(-c3ccc(Cl)cc3)c12.O.O |
| InChI | InChI=1S/C19H13ClN2O3S.2H2O/c1-9-7-12(10-3-5-11(20)6-4-10)15-16-17(26-18(15)21-9)14(25-2)8-13(22-16)19(23)24;;/h3-8H,1-2H3,(H,23,24);2*1H2 |
| InChIKey | SKPRGNHPEKVLMR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 135.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |