C20H21N3O2S2 — CID 10092352
6-methyl-3-(1-piperidin-1-ylethylideneamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 10092352) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 6-methyl-3-(1-piperidin-1-ylethylideneamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 6-methyl-3-(1-piperidin-1-ylethylideneamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 10092352 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 6-methyl-3-(1-piperidin-1-ylethylideneamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | C/C(=N\c1c(C(=O)O)sc2nc(C)cc(-c3cccs3)c12)N1CCCCC1 |
| InChI | InChI=1S/C20H21N3O2S2/c1-12-11-14(15-7-6-10-26-15)16-17(18(20(24)25)27-19(16)21-12)22-13(2)23-8-4-3-5-9-23/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,24,25)/b22-13+ |
| InChIKey | FMHVSGFPLOCELL-LPYMAVHISA-N |
| XLogP | 5.57 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|