C25H22FN3O3S — CID 10004597
4-(4-fluorophenyl)-6-(furan-2-yl)-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 10004597) has the molecular formula C25H22FN3O3S and a molecular weight of 463.53 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-6-(furan-2-yl)-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-6-(furan-2-yl)-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 10004597 |
| Molecular Formula | C25H22FN3O3S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 4-(4-fluorophenyl)-6-(furan-2-yl)-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | C/C(=N\c1c(C(=O)O)sc2nc(-c3ccco3)cc(-c3ccc(F)cc3)c12)N1CCCCC1 |
| InChI | InChI=1S/C25H22FN3O3S/c1-15(29-11-3-2-4-12-29)27-22-21-18(16-7-9-17(26)10-8-16)14-19(20-6-5-13-32-20)28-24(21)33-23(22)25(30)31/h5-10,13-14H,2-4,11-12H2,1H3,(H,30,31)/b27-15+ |
| InChIKey | HRWNBWMTKGCOGC-JFLMPSFJSA-N |
| XLogP | 6.60 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|