C22H18BrN3O4S — CID 10413634
4-(4-bromophenyl)-6-(furan-2-yl)-3-[[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 10413634) has the molecular formula C22H18BrN3O4S and a molecular weight of 500.37 g/mol. Its IUPAC name is 4-(4-bromophenyl)-6-(furan-2-yl)-3-[[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)-6-(furan-2-yl)-3-[[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 10413634 |
| Molecular Formula | C22H18BrN3O4S |
| Molecular Weight | 500.37 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 4-(4-bromophenyl)-6-(furan-2-yl)-3-[[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]amino]thieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | C/C(=N\CCO)Nc1c(C(=O)O)sc2nc(-c3ccco3)cc(-c3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C22H18BrN3O4S/c1-12(24-8-9-27)25-19-18-15(13-4-6-14(23)7-5-13)11-16(17-3-2-10-30-17)26-21(18)31-20(19)22(28)29/h2-7,10-11,27H,8-9H2,1H3,(H,24,25)(H,28,29) |
| InChIKey | MKYNOQUSGCWOMI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|