C20H20BrN3O3S — CID 10411997
4-(4-bromophenyl)-3-[[N-(3-hydroxypropyl)-C-methylcarbonimidoyl]amino]-6-methylthieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 10411997) has the molecular formula C20H20BrN3O3S and a molecular weight of 462.37 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-[[N-(3-hydroxypropyl)-C-methylcarbonimidoyl]amino]-6-methylthieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)-3-[[N-(3-hydroxypropyl)-C-methylcarbonimidoyl]amino]-6-methylthieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 10411997 |
| Molecular Formula | C20H20BrN3O3S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 4-(4-bromophenyl)-3-[[N-(3-hydroxypropyl)-C-methylcarbonimidoyl]amino]-6-methylthieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | C/C(=N\CCCO)Nc1c(C(=O)O)sc2nc(C)cc(-c3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C20H20BrN3O3S/c1-11-10-15(13-4-6-14(21)7-5-13)16-17(24-12(2)22-8-3-9-25)18(20(26)27)28-19(16)23-11/h4-7,10,25H,3,8-9H2,1-2H3,(H,22,24)(H,26,27) |
| InChIKey | JQFHUSJULZMXCH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|