C24H26BrN3O2S — CID 10028926
propan-2-yl 4-(4-bromophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 10028926) has the molecular formula C24H26BrN3O2S and a molecular weight of 500.46 g/mol. Its IUPAC name is propan-2-yl 4-(4-bromophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | propan-2-yl 4-(4-bromophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 10028926 |
| Molecular Formula | C24H26BrN3O2S |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | propan-2-yl 4-(4-bromophenyl)-6-methyl-3-(piperidin-1-ylmethylideneamino)thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | Cc1cc(-c2ccc(Br)cc2)c2c(/N=C/N3CCCCC3)c(C(=O)OC(C)C)sc2n1 |
| InChI | InChI=1S/C24H26BrN3O2S/c1-15(2)30-24(29)22-21(26-14-28-11-5-4-6-12-28)20-19(13-16(3)27-23(20)31-22)17-7-9-18(25)10-8-17/h7-10,13-15H,4-6,11-12H2,1-3H3/b26-14+ |
| InChIKey | UTXMRPSAINWMDZ-VULFUBBASA-N |
| XLogP | 6.75 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|