C19H15BrN4S2 — CID 135535270
12-(4-bromophenyl)-14-methyl-17-thia-3,7,9,15-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,9,11,13,15-pentaene-8-thione (PubChem CID 135535270) has the molecular formula C19H15BrN4S2 and a molecular weight of 443.40 g/mol. Its IUPAC name is 12-(4-bromophenyl)-14-methyl-17-thia-3,7,9,15-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,9,11,13,15-pentaene-8-thione.
| Compound Name | 12-(4-bromophenyl)-14-methyl-17-thia-3,7,9,15-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,9,11,13,15-pentaene-8-thione |
|---|---|
| PubChem CID | 135535270 |
| Molecular Formula | C19H15BrN4S2 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 12-(4-bromophenyl)-14-methyl-17-thia-3,7,9,15-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,9,11,13,15-pentaene-8-thione |
| SMILES | Cc1cc(-c2ccc(Br)cc2)c2c(n1)sc1c3n(c(=S)nc12)CCCN3 |
| InChI | InChI=1S/C19H15BrN4S2/c1-10-9-13(11-3-5-12(20)6-4-11)14-15-16(26-18(14)22-10)17-21-7-2-8-24(17)19(25)23-15/h3-6,9,21H,2,7-8H2,1H3 |
| InChIKey | ASZRCXGCPQXCAH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|