C22H23N3O4S — CID 10365087
6-(4-methoxyphenyl)-4-methyl-3-(1-morpholin-4-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 10365087) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-4-methyl-3-(1-morpholin-4-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 6-(4-methoxyphenyl)-4-methyl-3-(1-morpholin-4-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 10365087 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 6-(4-methoxyphenyl)-4-methyl-3-(1-morpholin-4-ylethylideneamino)thieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(-c2cc(C)c3c(/N=C(\C)N4CCOCC4)c(C(=O)O)sc3n2)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-13-12-17(15-4-6-16(28-3)7-5-15)24-21-18(13)19(20(30-21)22(26)27)23-14(2)25-8-10-29-11-9-25/h4-7,12H,8-11H2,1-3H3,(H,26,27)/b23-14+ |
| InChIKey | RWJUYYRAUWKESM-OEAKJJBVSA-N |
| XLogP | 4.36 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|