C22H25BrN4OS — CID 110193488
6-(4-bromophenyl)-3-(dimethylaminomethylideneamino)-N,N-diethyl-4-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 110193488) has the molecular formula C22H25BrN4OS and a molecular weight of 473.44 g/mol. Its IUPAC name is 6-(4-bromophenyl)-3-(dimethylaminomethylideneamino)-N,N-diethyl-4-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(4-bromophenyl)-3-(dimethylaminomethylideneamino)-N,N-diethyl-4-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110193488 |
| Molecular Formula | C22H25BrN4OS |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 6-(4-bromophenyl)-3-(dimethylaminomethylideneamino)-N,N-diethyl-4-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1sc2nc(-c3ccc(Br)cc3)cc(C)c2c1/N=C/N(C)C |
| InChI | InChI=1S/C22H25BrN4OS/c1-6-27(7-2)22(28)20-19(24-13-26(4)5)18-14(3)12-17(25-21(18)29-20)15-8-10-16(23)11-9-15/h8-13H,6-7H2,1-5H3/b24-13+ |
| InChIKey | ZSGAHGJWBOJHDZ-ZMOGYAJESA-N |
| XLogP | 5.74 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|