C29H22BrN3O2 — CID 10324505
N'-[2-(4-bromobenzoyl)-4,6-diphenylfuro[2,3-b]pyridin-3-yl]-N,N-dimethylmethanimidamide (PubChem CID 10324505) has the molecular formula C29H22BrN3O2 and a molecular weight of 524.42 g/mol. Its IUPAC name is N'-[2-(4-bromobenzoyl)-4,6-diphenylfuro[2,3-b]pyridin-3-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-(4-bromobenzoyl)-4,6-diphenylfuro[2,3-b]pyridin-3-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 10324505 |
| Molecular Formula | C29H22BrN3O2 |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | N'-[2-(4-bromobenzoyl)-4,6-diphenylfuro[2,3-b]pyridin-3-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1c(C(=O)c2ccc(Br)cc2)oc2nc(-c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C29H22BrN3O2/c1-33(2)18-31-26-25-23(19-9-5-3-6-10-19)17-24(20-11-7-4-8-12-20)32-29(25)35-28(26)27(34)21-13-15-22(30)16-14-21/h3-18H,1-2H3/b31-18+ |
| InChIKey | DSAVMYIWITYCCJ-FDAWAROLSA-N |
| XLogP | 7.38 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|