C27H19N5OS — CID 139267566
3-azido-N-methyl-N,4,6-triphenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 139267566) has the molecular formula C27H19N5OS and a molecular weight of 461.55 g/mol. Its IUPAC name is 3-azido-N-methyl-N,4,6-triphenylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-azido-N-methyl-N,4,6-triphenylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139267566 |
| Molecular Formula | C27H19N5OS |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 3-azido-N-methyl-N,4,6-triphenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CN(C(=O)c1sc2nc(-c3ccccc3)cc(-c3ccccc3)c2c1N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C27H19N5OS/c1-32(20-15-9-4-10-16-20)27(33)25-24(30-31-28)23-21(18-11-5-2-6-12-18)17-22(29-26(23)34-25)19-13-7-3-8-14-19/h2-17H,1H3 |
| InChIKey | KQEDRZFDVVHKLO-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 81.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|