C17H15N3OS — CID 39071360
2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 39071360) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39071360 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | CN(C(=O)c1sc(N)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3OS/c1-20(13-10-6-3-7-11-13)16(21)15-14(19-17(18)22-15)12-8-4-2-5-9-12/h2-11H,1H3,(H2,18,19) |
| InChIKey | KPOIEARGOYKKHW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |