About 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide
2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 39071360) has the molecular formula C17H15N3OS
and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 39071360 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | CN(C(=O)c1sc(N)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3OS/c1-20(13-10-6-3-7-11-13)16(21)15-14(19-17(18)22-15)12-8-4-2-5-9-12/h2-11H,1H3,(H2,18,19) |
| InChIKey | KPOIEARGOYKKHW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide (CID 39071360) is 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide is CN(C(=O)c1sc(N)nc1-c1ccccc1)c1ccccc1.
What is the InChIKey of 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide?
The InChIKey is KPOIEARGOYKKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3OS/c1-20(13-10-6-3-7-11-13)16(21)15-14(19-17(18)22-15)12-8-4-2-5-9-12/h2-11H,1H3,(H2,18,19).
What are the key properties of 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide?
2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide has a molecular weight of 309.39 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-methyl-N,4-diphenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 39071360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).