C20H19N3O4S — CID 10408500
1-[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]-1-methyl-3-phenylurea (PubChem CID 10408500) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]-1-methyl-3-phenylurea.
| Compound Name | 1-[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]-1-methyl-3-phenylurea |
|---|---|
| PubChem CID | 10408500 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]ethyl]-1-methyl-3-phenylurea |
| SMILES | CN(CCOc1ccc(/C=C2\SC(=O)NC2=O)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H19N3O4S/c1-23(19(25)21-15-5-3-2-4-6-15)11-12-27-16-9-7-14(8-10-16)13-17-18(24)22-20(26)28-17/h2-10,13H,11-12H2,1H3,(H,21,25)(H,22,24,26)/b17-13- |
| InChIKey | NCJMXUCDIHKQMW-LGMDPLHJSA-N |
| XLogP | 3.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|