C25H20FNO3 — CID 10408742
4-[[6-[3-(4-fluorophenyl)prop-1-ynyl]-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]benzoic acid (PubChem CID 10408742) has the molecular formula C25H20FNO3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 4-[[6-[3-(4-fluorophenyl)prop-1-ynyl]-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[6-[3-(4-fluorophenyl)prop-1-ynyl]-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10408742 |
| Molecular Formula | C25H20FNO3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[[6-[3-(4-fluorophenyl)prop-1-ynyl]-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2COc3ccc(C#CCc4ccc(F)cc4)cc3C2)cc1 |
| InChI | InChI=1S/C25H20FNO3/c26-23-11-6-18(7-12-23)2-1-3-19-8-13-24-22(14-19)16-27(17-30-24)15-20-4-9-21(10-5-20)25(28)29/h4-14H,2,15-17H2,(H,28,29) |
| InChIKey | JUJAHFLYAFBFOR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|