About 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine
3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine (PubChem CID 134122732) has the molecular formula C15H13F3N2O
and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine.
Molecular Properties
| Compound Name | 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine |
| PubChem CID | 134122732 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine |
| SMILES | FC(F)(F)c1ccc2c(c1)CN(Cc1ccncc1)CO2 |
| InChI | InChI=1S/C15H13F3N2O/c16-15(17,18)13-1-2-14-12(7-13)9-20(10-21-14)8-11-3-5-19-6-4-11/h1-7H,8-10H2 |
| InChIKey | ZFNGCVNTFXNVED-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine?
The IUPAC name of 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine (CID 134122732) is 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine.
What is the SMILES notation for 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine?
The canonical SMILES for 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine is FC(F)(F)c1ccc2c(c1)CN(Cc1ccncc1)CO2.
What is the InChIKey of 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine?
The InChIKey is ZFNGCVNTFXNVED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O/c16-15(17,18)13-1-2-14-12(7-13)9-20(10-21-14)8-11-3-5-19-6-4-11/h1-7H,8-10H2.
What are the key properties of 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine?
3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine has a molecular weight of 294.28 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pyridin-4-ylmethyl)-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine is sourced from PubChem (CID 134122732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).