C23H24F6N2O2S2 — CID 171401416
2-[6-[1,1,1,3,3,3-hexafluoro-2-[3-(2-sulfanylethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethanethiol (PubChem CID 171401416) has the molecular formula C23H24F6N2O2S2 and a molecular weight of 538.58 g/mol. Its IUPAC name is 2-[6-[1,1,1,3,3,3-hexafluoro-2-[3-(2-sulfanylethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethanethiol.
| Compound Name | 2-[6-[1,1,1,3,3,3-hexafluoro-2-[3-(2-sulfanylethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethanethiol |
|---|---|
| PubChem CID | 171401416 |
| Molecular Formula | C23H24F6N2O2S2 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 2-[6-[1,1,1,3,3,3-hexafluoro-2-[3-(2-sulfanylethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethanethiol |
| SMILES | FC(F)(F)C(c1ccc2c(c1)CN(CCS)CO2)(c1ccc2c(c1)CN(CCS)CO2)C(F)(F)F |
| InChI | InChI=1S/C23H24F6N2O2S2/c24-22(25,26)21(23(27,28)29,17-1-3-19-15(9-17)11-30(5-7-34)13-32-19)18-2-4-20-16(10-18)12-31(6-8-35)14-33-20/h1-4,9-10,34-35H,5-8,11-14H2 |
| InChIKey | FXHHALSOVMVQBJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|