C33H36N2O2 — CID 163923019
3-benzyl-6-[2-[3-(cyclohexa-1,3-dien-1-ylmethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 163923019) has the molecular formula C33H36N2O2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 3-benzyl-6-[2-[3-(cyclohexa-1,3-dien-1-ylmethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-benzyl-6-[2-[3-(cyclohexa-1,3-dien-1-ylmethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 163923019 |
| Molecular Formula | C33H36N2O2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 3-benzyl-6-[2-[3-(cyclohexa-1,3-dien-1-ylmethyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | CC(C)(c1ccc2c(c1)CN(CC1=CC=CCC1)CO2)c1ccc2c(c1)CN(Cc1ccccc1)CO2 |
| InChI | InChI=1S/C33H36N2O2/c1-33(2,29-13-15-31-27(17-29)21-34(23-36-31)19-25-9-5-3-6-10-25)30-14-16-32-28(18-30)22-35(24-37-32)20-26-11-7-4-8-12-26/h3-7,9-11,13-18H,8,12,19-24H2,1-2H3 |
| InChIKey | RCBKKDVDPOSDNA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |