C22H20FNO3 — CID 86643765
4-[2-fluoro-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoic acid (PubChem CID 86643765) has the molecular formula C22H20FNO3 and a molecular weight of 365.40 g/mol. Its IUPAC name is 4-[2-fluoro-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoic acid.
| Compound Name | 4-[2-fluoro-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoic acid |
|---|---|
| PubChem CID | 86643765 |
| Molecular Formula | C22H20FNO3 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[2-fluoro-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C(F)C#Cc2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H20FNO3/c23-21(15-18-5-8-20(9-6-18)22(25)26)10-7-17-1-3-19(4-2-17)16-24-11-13-27-14-12-24/h1-6,8-9,15H,11-14,16H2,(H,25,26) |
| InChIKey | AMDYIMGMORRTOL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|