C22H21NO3 — CID 59417436
4-[(Z)-4-[4-(morpholin-4-ylmethyl)phenyl]but-3-en-1-ynyl]benzoic acid (PubChem CID 59417436) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-[(Z)-4-[4-(morpholin-4-ylmethyl)phenyl]but-3-en-1-ynyl]benzoic acid.
| Compound Name | 4-[(Z)-4-[4-(morpholin-4-ylmethyl)phenyl]but-3-en-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 59417436 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-[(Z)-4-[4-(morpholin-4-ylmethyl)phenyl]but-3-en-1-ynyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C#C/C=C\c2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H21NO3/c24-22(25)21-11-9-19(10-12-21)4-2-1-3-18-5-7-20(8-6-18)17-23-13-15-26-16-14-23/h1,3,5-12H,13-17H2,(H,24,25)/b3-1- |
| InChIKey | GIGNGLHYHAMDNQ-IWQZZHSRSA-N |
| XLogP | 3.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|