C23H23NO3 — CID 59416999
methyl 4-[(E)-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoate (PubChem CID 59416999) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is methyl 4-[(E)-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoate.
| Compound Name | methyl 4-[(E)-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoate |
|---|---|
| PubChem CID | 59416999 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | methyl 4-[(E)-4-[4-(morpholin-4-ylmethyl)phenyl]but-1-en-3-ynyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C#Cc2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-26-23(25)22-12-10-20(11-13-22)5-3-2-4-19-6-8-21(9-7-19)18-24-14-16-27-17-15-24/h3,5-13H,14-18H2,1H3/b5-3+ |
| InChIKey | ABTZMLYOCPOOSE-HWKANZROSA-N |
| XLogP | 3.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|