C28H28N2O — CID 10409197
3-[(1S,12R)-13-(2-phenylethyl)-9,13-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-1-yl]phenol (PubChem CID 10409197) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is 3-[(1S,12R)-13-(2-phenylethyl)-9,13-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-1-yl]phenol.
| Compound Name | 3-[(1S,12R)-13-(2-phenylethyl)-9,13-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-1-yl]phenol |
|---|---|
| PubChem CID | 10409197 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-[(1S,12R)-13-(2-phenylethyl)-9,13-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-1-yl]phenol |
| SMILES | Oc1cccc([C@@]23CCN(CCc4ccccc4)[C@@H](Cc4[nH]c5ccccc5c42)C3)c1 |
| InChI | InChI=1S/C28H28N2O/c31-23-10-6-9-21(17-23)28-14-16-30(15-13-20-7-2-1-3-8-20)22(19-28)18-26-27(28)24-11-4-5-12-25(24)29-26/h1-12,17,22,29,31H,13-16,18-19H2/t22-,28-/m0/s1 |
| InChIKey | VKQDNMNJRBVFMC-DWACAAAGSA-N |
| XLogP | 5.42 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |