C26H26N2O — CID 10022797
(1R,16S)-1-(3-methoxyphenyl)-17-methyl-13,17-diazapentacyclo[14.3.1.02,14.03,12.06,11]icosa-2(14),3(12),4,6,8,10-hexaene (PubChem CID 10022797) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is (1R,16S)-1-(3-methoxyphenyl)-17-methyl-13,17-diazapentacyclo[14.3.1.02,14.03,12.06,11]icosa-2(14),3(12),4,6,8,10-hexaene.
| Compound Name | (1R,16S)-1-(3-methoxyphenyl)-17-methyl-13,17-diazapentacyclo[14.3.1.02,14.03,12.06,11]icosa-2(14),3(12),4,6,8,10-hexaene |
|---|---|
| PubChem CID | 10022797 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1R,16S)-1-(3-methoxyphenyl)-17-methyl-13,17-diazapentacyclo[14.3.1.02,14.03,12.06,11]icosa-2(14),3(12),4,6,8,10-hexaene |
| SMILES | COc1cccc([C@]23CCN(C)[C@H](Cc4[nH]c5c(ccc6ccccc65)c42)C3)c1 |
| InChI | InChI=1S/C26H26N2O/c1-28-13-12-26(18-7-5-8-20(14-18)29-2)16-19(28)15-23-24(26)22-11-10-17-6-3-4-9-21(17)25(22)27-23/h3-11,14,19,27H,12-13,15-16H2,1-2H3/t19-,26-/m1/s1 |
| InChIKey | XMJPFEITJQDCDN-NIYFSFCBSA-N |
| XLogP | 5.27 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |