C30H52 — CID 10409463
(8R,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 10409463) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (8R,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 10409463 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (8R,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@]2(C)C1=CC[C@@H]1[C@@]3(C)CCCC(C)(C)C3CC[C@]12C |
| InChI | InChI=1S/C30H52/c1-21(2)11-9-12-22(3)23-15-19-29(7)24(23)13-14-26-28(6)18-10-17-27(4,5)25(28)16-20-30(26,29)8/h13,21-23,25-26H,9-12,14-20H2,1-8H3/t22-,23+,25?,26-,28+,29-,30-/m1/s1 |
| InChIKey | CVMYEJUTSODBKG-BWSAEXGQSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|