About 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one
5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one (PubChem CID 10410546) has the molecular formula C26H24O6
and a molecular weight of 432.47 g/mol. Its IUPAC name is 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one |
| PubChem CID | 10410546 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one |
| SMILES | COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H24O6/c1-29-20-10-4-17(5-11-20)16-23-24(18-6-12-21(30-2)13-7-18)25(27)32-26(23,28)19-8-14-22(31-3)15-9-19/h4-15,28H,16H2,1-3H3 |
| InChIKey | JCPFQTABMZGRMJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one?
The IUPAC name of 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one (CID 10410546) is 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one.
What is the SMILES notation for 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one?
The canonical SMILES for 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one is COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1.
What is the InChIKey of 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one?
The InChIKey is JCPFQTABMZGRMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24O6/c1-29-20-10-4-17(5-11-20)16-23-24(18-6-12-21(30-2)13-7-18)25(27)32-26(23,28)19-8-14-22(31-3)15-9-19/h4-15,28H,16H2,1-3H3.
What are the key properties of 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one?
5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one has a molecular weight of 432.47 g/mol, XLogP of 4.11, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,5-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methyl]furan-2-one is sourced from PubChem (CID 10410546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).