C25H19NO8 — CID 10623877
3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxyphenyl)-4-[(4-nitrophenyl)methyl]furan-2-one (PubChem CID 10623877) has the molecular formula C25H19NO8 and a molecular weight of 461.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxyphenyl)-4-[(4-nitrophenyl)methyl]furan-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxyphenyl)-4-[(4-nitrophenyl)methyl]furan-2-one |
|---|---|
| PubChem CID | 10623877 |
| Molecular Formula | C25H19NO8 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxyphenyl)-4-[(4-nitrophenyl)methyl]furan-2-one |
| SMILES | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H19NO8/c1-31-19-9-5-17(6-10-19)25(28)20(12-15-2-7-18(8-3-15)26(29)30)23(24(27)34-25)16-4-11-21-22(13-16)33-14-32-21/h2-11,13,28H,12,14H2,1H3 |
| InChIKey | IUBQFXBBEJQVMV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|