C24H17ClO5 — CID 19362988
3-(1,3-benzodioxol-5-yl)-4-benzyl-5-(3-chlorophenyl)-5-hydroxyfuran-2-one (PubChem CID 19362988) has the molecular formula C24H17ClO5 and a molecular weight of 420.85 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-benzyl-5-(3-chlorophenyl)-5-hydroxyfuran-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-benzyl-5-(3-chlorophenyl)-5-hydroxyfuran-2-one |
|---|---|
| PubChem CID | 19362988 |
| Molecular Formula | C24H17ClO5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-benzyl-5-(3-chlorophenyl)-5-hydroxyfuran-2-one |
| SMILES | O=C1OC(O)(c2cccc(Cl)c2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H17ClO5/c25-18-8-4-7-17(13-18)24(27)19(11-15-5-2-1-3-6-15)22(23(26)30-24)16-9-10-20-21(12-16)29-14-28-20/h1-10,12-13,27H,11,14H2 |
| InChIKey | WPNFUFDTRKZVGJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |