C35H40O8 — CID 19363029
3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxy-3-methylphenyl)-4-[(3-methoxy-4-octoxyphenyl)methyl]furan-2-one (PubChem CID 19363029) has the molecular formula C35H40O8 and a molecular weight of 588.70 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxy-3-methylphenyl)-4-[(3-methoxy-4-octoxyphenyl)methyl]furan-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxy-3-methylphenyl)-4-[(3-methoxy-4-octoxyphenyl)methyl]furan-2-one |
|---|---|
| PubChem CID | 19363029 |
| Molecular Formula | C35H40O8 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxy-3-methylphenyl)-4-[(3-methoxy-4-octoxyphenyl)methyl]furan-2-one |
| SMILES | CCCCCCCCOc1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)c(C)c2)cc1OC |
| InChI | InChI=1S/C35H40O8/c1-5-6-7-8-9-10-17-40-29-14-11-24(20-31(29)39-4)19-27-33(25-12-15-30-32(21-25)42-22-41-30)34(36)43-35(27,37)26-13-16-28(38-3)23(2)18-26/h11-16,18,20-21,37H,5-10,17,19,22H2,1-4H3 |
| InChIKey | SVQKSXWWIQYJFB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|