C21H33N2O6P — CID 10410979
[(1R)-1-[(1S)-1-acetamido-2-amino-2-oxoethyl]-2,3-dihydro-1H-inden-5-yl] ditert-butyl phosphate (PubChem CID 10410979) has the molecular formula C21H33N2O6P and a molecular weight of 440.48 g/mol. Its IUPAC name is [(1R)-1-[(1S)-1-acetamido-2-amino-2-oxoethyl]-2,3-dihydro-1H-inden-5-yl] ditert-butyl phosphate.
| Compound Name | [(1R)-1-[(1S)-1-acetamido-2-amino-2-oxoethyl]-2,3-dihydro-1H-inden-5-yl] ditert-butyl phosphate |
|---|---|
| PubChem CID | 10410979 |
| Molecular Formula | C21H33N2O6P |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [(1R)-1-[(1S)-1-acetamido-2-amino-2-oxoethyl]-2,3-dihydro-1H-inden-5-yl] ditert-butyl phosphate |
| SMILES | CC(=O)N[C@H](C(N)=O)[C@@H]1CCc2cc(OP(=O)(OC(C)(C)C)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C21H33N2O6P/c1-13(24)23-18(19(22)25)17-10-8-14-12-15(9-11-16(14)17)27-30(26,28-20(2,3)4)29-21(5,6)7/h9,11-12,17-18H,8,10H2,1-7H3,(H2,22,25)(H,23,24)/t17-,18+/m1/s1 |
| InChIKey | KDQLYKPFPXQQRY-MSOLQXFVSA-N |
| XLogP | 3.82 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|