C22H20O6S2 — CID 10411202
methyl 3,5-bis(benzenesulfonyl)-1,2,6,6a-tetrahydropentalene-1-carboxylate (PubChem CID 10411202) has the molecular formula C22H20O6S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl 3,5-bis(benzenesulfonyl)-1,2,6,6a-tetrahydropentalene-1-carboxylate.
| Compound Name | methyl 3,5-bis(benzenesulfonyl)-1,2,6,6a-tetrahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 10411202 |
| Molecular Formula | C22H20O6S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | methyl 3,5-bis(benzenesulfonyl)-1,2,6,6a-tetrahydropentalene-1-carboxylate |
| SMILES | COC(=O)C1CC(S(=O)(=O)c2ccccc2)=C2C=C(S(=O)(=O)c3ccccc3)CC21 |
| InChI | InChI=1S/C22H20O6S2/c1-28-22(23)20-14-21(30(26,27)16-10-6-3-7-11-16)19-13-17(12-18(19)20)29(24,25)15-8-4-2-5-9-15/h2-11,13,18,20H,12,14H2,1H3 |
| InChIKey | GTFDUWBZMVATDY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |