C22H21ClN2O4S — CID 10411233
(E)-1-(4-acetylpiperazin-1-yl)-3-[4-(1,3-benzodioxol-5-ylsulfanyl)-3-chlorophenyl]prop-2-en-1-one (PubChem CID 10411233) has the molecular formula C22H21ClN2O4S and a molecular weight of 444.94 g/mol. Its IUPAC name is (E)-1-(4-acetylpiperazin-1-yl)-3-[4-(1,3-benzodioxol-5-ylsulfanyl)-3-chlorophenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[4-(1,3-benzodioxol-5-ylsulfanyl)-3-chlorophenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10411233 |
| Molecular Formula | C22H21ClN2O4S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[4-(1,3-benzodioxol-5-ylsulfanyl)-3-chlorophenyl]prop-2-en-1-one |
| SMILES | CC(=O)N1CCN(C(=O)/C=C/c2ccc(Sc3ccc4c(c3)OCO4)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H21ClN2O4S/c1-15(26)24-8-10-25(11-9-24)22(27)7-3-16-2-6-21(18(23)12-16)30-17-4-5-19-20(13-17)29-14-28-19/h2-7,12-13H,8-11,14H2,1H3/b7-3+ |
| InChIKey | FKFWCWLZUOSSNM-XVNBXDOJSA-N |
| XLogP | 3.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|