C23H46O6P2 — CID 10412888
(6E)-13,13-bis(diethoxyphosphoryl)-2,6-dimethyltrideca-2,6-diene (PubChem CID 10412888) has the molecular formula C23H46O6P2 and a molecular weight of 480.56 g/mol. Its IUPAC name is (6E)-13,13-bis(diethoxyphosphoryl)-2,6-dimethyltrideca-2,6-diene.
| Compound Name | (6E)-13,13-bis(diethoxyphosphoryl)-2,6-dimethyltrideca-2,6-diene |
|---|---|
| PubChem CID | 10412888 |
| Molecular Formula | C23H46O6P2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | (6E)-13,13-bis(diethoxyphosphoryl)-2,6-dimethyltrideca-2,6-diene |
| SMILES | CCOP(=O)(OCC)C(CCCCC/C=C(\C)CCC=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C23H46O6P2/c1-8-26-30(24,27-9-2)23(31(25,28-10-3)29-11-4)20-15-13-12-14-18-22(7)19-16-17-21(5)6/h17-18,23H,8-16,19-20H2,1-7H3/b22-18+ |
| InChIKey | IDAJPJVDNSMMFV-RELWKKBWSA-N |
| XLogP | 8.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|