C23H39O10P — CID 10413858
(2R,3R,4S,5R,6S)-2-(2-diethoxyphosphorylethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane (PubChem CID 10413858) has the molecular formula C23H39O10P and a molecular weight of 506.53 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(2-diethoxyphosphorylethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane.
| Compound Name | (2R,3R,4S,5R,6S)-2-(2-diethoxyphosphorylethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 10413858 |
| Molecular Formula | C23H39O10P |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(2-diethoxyphosphorylethyl)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane |
| SMILES | CCOP(=O)(CC[C@H]1O[C@H](OC)[C@H](OCOC)[C@@H](OCOC)[C@@H]1OCc1ccccc1)OCC |
| InChI | InChI=1S/C23H39O10P/c1-6-31-34(24,32-7-2)14-13-19-20(28-15-18-11-9-8-10-12-18)21(29-16-25-3)22(30-17-26-4)23(27-5)33-19/h8-12,19-23H,6-7,13-17H2,1-5H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | VPLQRRUHXYNBSK-ZQGJOIPISA-N |
| XLogP | 3.58 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|