C10H16O3 — CID 10419871
(5S)-5-cyclohexyl-2-methyl-1,3-dioxolan-4-one (PubChem CID 10419871) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (5S)-5-cyclohexyl-2-methyl-1,3-dioxolan-4-one.
| Compound Name | (5S)-5-cyclohexyl-2-methyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 10419871 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (5S)-5-cyclohexyl-2-methyl-1,3-dioxolan-4-one |
| SMILES | CC1OC(=O)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C10H16O3/c1-7-12-9(10(11)13-7)8-5-3-2-4-6-8/h7-9H,2-6H2,1H3/t7?,9-/m0/s1 |
| InChIKey | YSCZSUMMGFWWAT-NETXQHHPSA-N |
| XLogP | 1.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |