C10H9N5 — CID 10420296
2-methylpurino[9,8-a]pyridin-4-amine (PubChem CID 10420296) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 2-methylpurino[9,8-a]pyridin-4-amine.
| Compound Name | 2-methylpurino[9,8-a]pyridin-4-amine |
|---|---|
| PubChem CID | 10420296 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2-methylpurino[9,8-a]pyridin-4-amine |
| SMILES | Cc1nc(N)c2nc3ccccn3c2n1 |
| InChI | InChI=1S/C10H9N5/c1-6-12-9(11)8-10(13-6)15-5-3-2-4-7(15)14-8/h2-5H,1H3,(H2,11,12,13) |
| InChIKey | RNQPJFMRBSYCFG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |